![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | ການລົງທຶນລັດ ແລະ ເອກະຊົນ 624ລບ2020.pdf | 2023-05-18 07:51 | 1.5M | |
![[ ]](/icons/layout.gif) | ຂໍອະນຸຍາດໂຄສະນາອາຫານ, ຢາ ແລະ ຜະລິດຕະພັນການແພດ.pdf | 2023-06-16 16:06 | 75K | |
![[ ]](/icons/layout.gif) | ຂໍ້ກໍານົດວ່າດ້ວຍການກໍານົດບັນຊີພືດ ແລະ ຕົ້ນໄມ້ເປັນຢາ ບັນຊີ I II III.pdf | 2022-11-08 09:04 | 3.6M | |
![[ ]](/icons/layout.gif) | ຂໍ້ກໍານົດວ່າດ້ວຍການຄຸ້ມຄອງຄຸນນະພາບເຄື່ອງສໍາອາງ (ພາສາອັງກິດ).pdf | 2022-06-30 16:12 | 210K | |
![[ ]](/icons/layout.gif) | ຂໍ້ກໍານົດວ່າດ້ວຍການຄຸ້ມຄອງຜະລິດຕະພັນເຄື່ອງສໍາອາງ.pdf | 2022-06-30 16:06 | 199K | |
![[ ]](/icons/layout.gif) | ຂໍ້ຕົກລົງ ວ່າດ້ວຍການຂຶ້ນທະບຽນອາຫານ (ສະບັບປັບປຸງ), 2023..pdf | 2023-09-07 13:31 | 4.3M | |
![[ ]](/icons/layout.gif) | ຂໍ້ຕົກລົງ ວ່າດ້ວຍການຂຶ້ນທະບຽນອາຫານ (ສະບັບປັບປຸງ).pdf | 2023-09-28 15:39 | 4.3M | |
![[ ]](/icons/layout.gif) | ຂໍ້ຕົກລົງວ່າດ້ວຍການຂຶ້ນທະບຽນ ແລະ ຈົດແຈ້ງອຸປະກອນການແພດ ສະບັບເລກ.pdf | 2023-07-21 15:17 | 4.2M | |
![[ ]](/icons/layout.gif) | ຂໍ້ຕົກລົງວ່າດ້ວຍການຄຸ້ມຄອງຜະລິດຕະພັນເຄື່ອງສຳອາງ (ສະບັບປັບປຸງ).pdf | 2023-07-26 14:10 | 758K | |
![[ ]](/icons/unknown.gif) | ຂໍ້ຕົກລົງວ່າດ້ວຍການຄຸ້ມຄອງລາຄາຢາ ແລະ ຜະລິດຕະພັນການແພດ (1).PDF | 2023-04-19 15:33 | 4.9M | |
![[ ]](/icons/unknown.gif) | ຂໍ້ຕົກລົງວ່າດ້ວຍການຄຸ້ມຄອງລາຄາຢາ ແລະ ຜະລິດຕະພັນການແພດ (2).PDF | 2023-08-02 15:08 | 4.9M | |
![[ ]](/icons/layout.gif) | ຂໍ້ຕົກລົງວ່າດ້ວຍການຈັດຊື້ຈັດຈ້າງສິນຄ້າປະເພດຢາ,ຜະລິດຕະພັນການແ.pdf | 2022-07-12 13:13 | 6.6M | |
![[ ]](/icons/unknown.gif) | ຂໍ້ຕົກລົງວ່າດ້ວຍການສົ່ງອອກ-ນໍາເຂົ້າ ແລະສົ່ງຜ່ານອາຫານ.PDF | 2023-05-03 10:03 | 5.9M | |
![[ ]](/icons/layout.gif) | ຂໍ້ຕົກລົງ ວ່າດ້ວຍນ້ຳດື່ມໃນພາຊະນະບັນຈຸປິດ (ສະບັບປັບປຸງ), 2023.pdf | 2023-09-07 13:34 | 2.8M | |
![[ ]](/icons/layout.gif) | ຂໍ້ຕົກລົງ ວ່າດ້ວຍນ້ຳດື່ມໃນພາຊະນະບັນຈຸປິດ (ສະບັບປັບປຸງ).pdf | 2023-09-28 15:31 | 2.8M | |
![[ ]](/icons/layout.gif) | ຂໍ້ຕົກລົງ_ວ່າດ້ວຍ_ການຈັດຊື້_ຈັດຈ້າງ_ສິນຄ້າ_ປະເພດຢາ_ຜະລິດຕະພັນການ.pdf | 2023-01-04 12:56 | 6.6M | |
![[ ]](/icons/unknown.gif) | ຂໍ້ມູນກ່ຽວກັບການຂໍຈົດແຈ້ງ .docx | 2023-06-21 13:03 | 19K | |
![[ ]](/icons/layout.gif) | ຂໍ້_ຕົກ_ລົງ ປໍ_ແກ້ວ.pdf | 2022-06-27 14:10 | 1.9M | |
![[ ]](/icons/layout.gif) | ຄຳຮ້ອງຂໍຂື້ນທະບຽນອາຫານນຳເຂົ້າຈາກຕ່າງປະເທດ.pdf | 2023-02-10 08:02 | 86K | |
![[ ]](/icons/layout.gif) | ບັນຊີຄວາມສ່ຽງເຄື່ອງສຳອາງ.pdf | 2022-06-30 15:02 | 184K | |
![[ ]](/icons/unknown.gif) | ບັນຊີລາຍການເຄື່ອງສໍາອາງຈົດແຈ້ງ ປັບປຸງ ເດືອນ 7 2022.xlsx | 2022-07-05 11:19 | 118K | |
![[ ]](/icons/unknown.gif) | ຜະລິດພາຍໃນ-ຄຳຮ້ອງຂໍອະນຸຍາດຜະລິດຢາຕົວຢ່າງ ເພື່ອຂໍຂື້ນທະບຽນຕຳລາຢາຜະລິດພາຍໃນປະເທດ (ຟອມ 1).docx | 2023-05-17 15:26 | 190K | |
![[ ]](/icons/unknown.gif) | ຢານໍາເຂົ້າ-ບັນຊີລາຍການເອກະສານທີ່ຮຽກຮ້ອງສໍາລັບປະກອບການຂໍຈົດທະບຽນຜະລິດຕະພັນຢານໍາເຂົ້າ.doc | 2023-05-17 15:29 | 439K | |
![[ ]](/icons/unknown.gif) | ຢານໍາເຂົ້າ-ຟອມຄໍາຮ້ອງຂໍຈົດທະບຽນຢາ ສໍາລັບຢານໍາເຂົ້າ (ຟອມ 2),,.doc | 2023-05-17 15:40 | 478K | |
![[ ]](/icons/unknown.gif) | ຢານໍາເຂົ້າ-ຟອມຄໍາຮ້ອງຂໍຈົດທະບຽນຢາ ສໍາລັບຢານໍາເຂົ້າ (ຟອມ 2).doc | 2023-05-17 15:37 | 478K | |
![[ ]](/icons/unknown.gif) | ຢານໍາເຂົ້າ-ຟອມຄໍາຮ້ອງຂໍຕໍ່ທະບຽນຢາ ສໍາລັບຢານໍາເຂົ້າ (ຟອມ 3).doc | 2023-05-17 15:27 | 72K | |
![[ ]](/icons/layout.gif) | ລາຍການຂື້ນທະບຽນຜະລິດຕະພັນນຳເຂົ້າ.pdf | 2023-05-30 09:10 | 430K | |
![[ ]](/icons/layout.gif) | ລາຍການຂື້ນທະບຽນຢາພື້ນເມືອງຜະລິດພາຍໃນ.pdf | 2023-05-30 09:04 | 189K | |
![[ ]](/icons/layout.gif) | ລາຍການຂ ້ນທະບຽນຜະລິດຕະພຼັນເສີມສ ຂະພາບ ຜະລິດພາຍໃນ.pdf | 2023-05-30 09:09 | 81K | |
![[ ]](/icons/unknown.gif) | ລາຍການຢາຂື້ນທະບຽນ ອັບເດດ 31-August-2023.xlsx | 2023-09-05 08:25 | 501K | |
![[ ]](/icons/layout.gif) | ລາຍການຢາພື້ນເມືອງນຳເຂົ້້າ Data of TI product_update Feb.2023.pdf | 2023-05-30 09:07 | 254K | |
![[ ]](/icons/unknown.gif) | ສະຖິຕິການຂື້ນທະບຽນອາຫານນຳເຂົ້າ11.xlsx | 2023-01-26 13:00 | 35K | |
![[ ]](/icons/layout.gif) | ເອກະສານຊ້ອນທ້າຍທີ III_ບັນດາສານທີ່ຈຳກັດປະລິມານໃຊ້ໃນເຄື່ອງສຳອາງ ປັບປຸງຄັ້ງວັນທີ 22.06.2022.pdf | 2022-06-30 15:35 | 1.8M | |
![[ ]](/icons/layout.gif) | ເອກະສານຊ້ອນທ້າຍທີ IV Part 1 ບັນດາສີທີ່ອະນຸຍາດໃຫ້ນຳໃຊ້ໃນເຄື່ອງສຳອາງ ປັບປຸງຄັ້ງວັນທີ 11.06.2021.pdf | 2022-06-30 15:38 | 223K | |
![[ ]](/icons/layout.gif) | ເອກະສານຊ້ອນທ້າຍທີ VII_ບັນດາສານກັນແດດທີ່ຈຳກັດປະລິມານໃຊ້ໃນເຄື່ອງສຳອາງ ປັບປຸງຄັ້ງວັນທີ 15.11.2021.pdf | 2022-07-01 12:49 | 165K | |
![[ ]](/icons/layout.gif) | ເອກະສານຊ້ອນທ້າຍທີ VI_ບັນດາສານກັນບູດທີ່ອະນຸຍາດໃຫ້ນຳໃຊ້ໃນເຄື່ອງສຳອາງ ປັບປຸງຄັ້ງວັນທີ 22.06.2022.pdf | 2022-06-30 15:36 | 261K | |
![[ ]](/icons/layout.gif) | ເອກະສານຊ້ອນທ້ານທີ II__ບັນດາສານທີ່ຫ້າມໃຊ້ເປັນສ່ວນປະສົມໃນເຄື່ອງສຳອາງ ປັບປຸງຄັ້ງວັນທີ 22.06.2022.pdf | 2022-06-30 15:34 | 1.5M | |
![[ ]](/icons/layout.gif) | ແບບຟອມຂໍນຳເຂົ້າອາຫານ.pdf | 2023-02-10 08:03 | 146K | |
![[ ]](/icons/unknown.gif) | 1. ໜັງສືສະ_ເໜີ_ຂໍໃບອະນຸຍາດດ້ານ_ວິຊາ_ການ.docx | 2023-06-21 12:55 | 39K | |
![[ ]](/icons/layout.gif) | 1. 08 List of Nacotic and Chemical (1).pdf | 2022-05-06 08:11 | 173K | |
![[ ]](/icons/layout.gif) | 1SOP-ໄລຍະເວລາ ແລະ ຂັ້ນຕອນການພິຈາລະນາການຈົດແຈ້ງເຄື່ອງສໍາອາງ.pdf | 2022-07-12 09:56 | 61K | |
![[ ]](/icons/layout.gif) | 2. 456 Nacotic- controlled chemist and precocure regulation (2).pdf | 2022-05-06 08:16 | 174K | |
![[ ]](/icons/layout.gif) | 3. RedList_16thEd_Jan2018_E.pdf | 2022-05-06 08:27 | 624K | |
![[ ]](/icons/unknown.gif) | 2016-10-21_022422pm_ໃບສະເໜີຂໍອະນຸຍາດນໍາເຂົ້າຢາເສບຕິດ.docx | 2018-05-29 08:16 | 26K | |
![[ ]](/icons/unknown.gif) | 2016-10-21_022815pm_ຂໍອະນຸຍາດນຳເຂົ້າຕົວຈິງຢາເສບຕິດ, ວັດຖຸອອກລິດຕໍ່ຈິດ-ປະສາດ..docx | 2018-05-29 08:16 | 26K | |
![[ ]](/icons/unknown.gif) | 2016-10-21_023109pm_ຂໍອະນຸຍາດນຳເຂົ້າຕົວຈິງຢາເສບຕິດ, ວັດຖຸອອກລິດຕໍ່ຈິດ-ປະສາດ..docx | 2018-05-29 08:16 | 26K | |
![[ ]](/icons/unknown.gif) | 2016-10-21_025401pm_ຂໍອະນຸຍາດທາງການກ່ອນຈະນຳເຂົ້າຢາເສບຕິດ, ວັດຖຸອອກລິດຕໍ່ຈິດ-ປະສາດ.docx | 2018-05-29 08:16 | 25K | |
![[ ]](/icons/unknown.gif) | 2016-10-21_025747pm_ຂໍອະນຸຍາດທາງການກ່ອນຈະນຳເຂົ້າຢາເສບຕິດ, ວັດຖຸອອກລິດຕໍ່ຈິດ-ປະສາດ.docx | 2018-05-29 08:16 | 25K | |
![[ ]](/icons/layout.gif) | 2017-01-03_044357pm_Food inspection regulation final_08.02.2012[1] updat and sign.pdf | 2018-05-29 08:16 | 242K | |
![[ ]](/icons/layout.gif) | 2017-01-09_034148pm_AMDD Version 15 Final Legally Scrubbed Lao.pdf | 2018-05-29 08:16 | 434K | |
![[ ]](/icons/layout.gif) | 2017-01-09_034802pm_AMDD Version 15 Final Legally Scrubbed Lao.pdf | 2018-05-29 08:16 | 434K | |
![[ ]](/icons/unknown.gif) | 2017-01-09_042915pm_ຮ່າງແບບຟອມຈົດແຈ້ງເຄື່ອງສໍາອາງnotification form.doc | 2018-05-29 08:16 | 168K | |
![[ ]](/icons/unknown.gif) | 2017-01-09_043135pm_ຮ່າງໃບສະເຫນີຂໍອະນຸຍາດຈົດແຈ້ງຜະລິດຕະພັນເຄື່ອງສຳອາງ.docx | 2018-05-29 08:16 | 50K | |
![[ ]](/icons/unknown.gif) | 2017-01-09_043313pm_ຮ່າງໃບສະເຫນີຂໍອະນຸຍາດຈົດແຈ້ງຜະລິດຕະພັນເຄື່ອງສຳອາງ.docx | 2018-05-29 08:16 | 50K | |
![[ ]](/icons/unknown.gif) | 2017-01-10_125029pm_ຂໍອະນຸຍາດນຳເຂົ້າສານເຄມີ.docx | 2018-05-29 08:16 | 41K | |
![[ ]](/icons/layout.gif) | 2017-01-11_034942pm_AMDD MRA.pdf | 2018-05-29 08:18 | 38M | |
![[ ]](/icons/layout.gif) | 2017-01-11_035407pm_AMDD MRA.pdf | 2018-05-29 08:16 | 38M | |
![[ ]](/icons/layout.gif) | 2017-01-11_040226pm_AMDD MRA.pdf | 2018-05-29 08:16 | 38M | |
![[ ]](/icons/unknown.gif) | 2017-02-07_113709am_ຮ່າງແບບຟອມຂໍອະນຸຍາດນໍາເຂົ້າຢາເສບຕິດ.docx | 2018-05-29 08:12 | 21K | |
![[ ]](/icons/layout.gif) | 2017-02-16_044152pm_List of drug registration updated 17 Feb 2017.pdf | 2018-05-29 08:12 | 1.6M | |
![[ ]](/icons/layout.gif) | 2017-02-17_034838pm_List_of_drug_registration_updated_Feb-17-2017.pdf | 2018-05-29 08:12 | 1.6M | |
![[ ]](/icons/layout.gif) | 2017-04-20_104235am_Establish company.pdf | 2018-05-29 08:12 | 127K | |
![[ ]](/icons/unknown.gif) | 2017-04-20_104401am_Establish company.docx | 2018-05-29 08:12 | 185K | |
![[ ]](/icons/unknown.gif) | 2017-04-26_020202pm_Application Form No. 1.docx | 2018-05-29 08:12 | 186K | |
![[ ]](/icons/unknown.gif) | 2017-05-08_045105pm_Assistant Pharmacy.doc | 2018-05-29 08:12 | 292K | |
![[ ]](/icons/unknown.gif) | 2017-05-08_045432pm_Inspection form for new pharmacy.doc | 2018-05-29 08:12 | 312K | |
![[ ]](/icons/layout.gif) | 2017-05-11_051020pm_Updated list of cosmetic May 2017.pdf | 2018-05-29 08:11 | 588K | |
![[ ]](/icons/layout.gif) | 2017-05-25_081401am_Regulation on cosmetict products (English)-1.pdf | 2018-05-29 08:11 | 210K | |
![[ ]](/icons/layout.gif) | 2017-05-25_081501am_Regulation on cosmetict products (English)-1.pdf | 2018-05-29 08:11 | 210K | |
![[ ]](/icons/layout.gif) | 2017-05-25_081624am_Regulation on cosmetict products (English)-1.pdf | 2018-05-29 08:11 | 210K | |
![[ ]](/icons/layout.gif) | 2017-05-25_082101am_Regulation on Cosmetic Control Lao Languase.pdf | 2018-05-29 08:11 | 199K | |
![[ ]](/icons/layout.gif) | 2017-05-25_084132am_ກົດໝາຍວ່າດ້ວຍການຄູ້ມຄອງເຄມີ.pdf | 2018-05-29 08:11 | 1.5M | |
![[ ]](/icons/layout.gif) | 2017-06-30_032212pm_53.Handling_Petition30_01_2015.pdf | 2018-05-29 08:11 | 2.8M | |
![[ ]](/icons/layout.gif) | 2017-07-07_023912pm_Agreement on MRA for GMP Pharmaceutical.pdf | 2018-05-29 08:11 | 725K | |
![[ ]](/icons/layout.gif) | 2017-07-21_100413am_Regulation on Drug and Medical Products Production in English version.pdf | 2018-05-29 08:10 | 228K | |
![[ ]](/icons/layout.gif) | 2017-07-21_100548am_Regulation on Drug and Medical Products Production in English version.pdf | 2018-05-29 08:10 | 228K | |
![[ ]](/icons/layout.gif) | 2017-07-21_100628am_Regulation on Drug Donation English version.pdf | 2018-05-29 08:10 | 183K | |
![[ ]](/icons/layout.gif) | 2017-07-21_100725am_Regulation on Establishment on Export_Import Drug and Medical Products Company Eng Version.pdf | 2018-05-29 08:10 | 211K | |
![[ ]](/icons/layout.gif) | 2017-07-21_100808am_Regulation on Drug Donation English version.pdf | 2018-05-29 08:10 | 183K | |
![[ ]](/icons/layout.gif) | 2017-07-21_101043am_Regulation on Drug Donation English version.pdf | 2018-05-29 08:10 | 183K | |
![[ ]](/icons/layout.gif) | 2017-07-21_101146am_Regulation on Establishment on Export_Import Drug and Medical Products Company Eng Version.pdf | 2018-05-29 08:10 | 211K | |
![[ ]](/icons/layout.gif) | 2017-08-31_094953am_Regulation on pharmaceutical and medical product establishment 23062017 Final.pdf | 2018-05-29 08:10 | 446K | |
![[ ]](/icons/unknown.gif) | 2017-09-05_080954pm_request form 1 for water soure analysis.docx | 2018-05-29 08:10 | 52K | |
![[ ]](/icons/unknown.gif) | 2017-09-05_081050pm_request form for drinking water analysis.docx | 2018-05-29 08:09 | 50K | |
![[ ]](/icons/layout.gif) | 2017-09-13_021438pm_Law on Medical Products (Eng).pdf | 2018-05-29 08:09 | 71K | |
![[ ]](/icons/unknown.gif) | 2017-12-21_030507pm_ຄໍາຮ້ອງຂໍອະນຸຍາດທະບຽນວິຊາຊີບເພສັດຊະກຳບໍລິສັດ.docx | 2018-05-29 08:07 | 271K | |
![[ ]](/icons/unknown.gif) | 2017-12-21_031403pm_ແບບຮ່າງຄໍາຮ້ອງຂໍຕໍ່ທະບຽນວິຊາຊີບເພສັດຊະກຳບໍລິສັດ.docx | 2018-05-29 08:07 | 191K | |
![[ ]](/icons/unknown.gif) | 2017-12-21_031529pm_ແບບຮ່າງຄໍາຮ້ອງຂໍຕໍ່ທະບຽນວິຊາຊີບເພສັດຊະກຳບໍລິສັດ.docx | 2018-05-29 08:06 | 191K | |
![[ ]](/icons/unknown.gif) | 2017-12-21_031728pm_ຄໍາຮ້ອງຂໍອະນຸຍາດທະບຽນວິຊາຊີບເພສັດຊະກຳບໍລິສັດ.docx | 2018-05-29 08:06 | 271K | |
![[ ]](/icons/unknown.gif) | 2017-12-21_032241pm_ຄໍາຮ້ອງຂໍຍົກຍ້າຍບໍລິສັດ.docx | 2018-05-29 08:06 | 264K | |
![[ ]](/icons/unknown.gif) | 2017-12-21_032510pm_ຄໍາຮ້ອງຂໍຍົກຍ້າຍບໍລິສັດ.docx | 2018-05-29 08:06 | 264K | |
![[ ]](/icons/unknown.gif) | 2017-12-21_032602pm_ຄໍາຮ້ອງຂໍຍົກຍ້າຍບໍລິສັດ.docx | 2018-05-29 08:06 | 264K | |
![[ ]](/icons/layout.gif) | 2018-02-20_040227pm_List_of_EML_21_03_2016_EML.pdf | 2018-05-29 08:06 | 1.4M | |
![[ ]](/icons/layout.gif) | 2018-02-20_040413pm_List_of_EML_21_03_2016_EML.pdf | 2018-05-29 08:06 | 1.4M | |
![[ ]](/icons/layout.gif) | 2018-02-20_040534pm_List_of_EML_21_03_2016_EML.pdf | 2018-05-29 08:06 | 1.4M | |
![[ ]](/icons/unknown.gif) | 2018-02-20_041242pm_PV Guideline.rar | 2018-05-29 08:05 | 1.5M | |
![[ ]](/icons/layout.gif) | 2018-06-06_093351pm_List of Drug Registration 6-6-18_Revised_Finaly.pdf | 2018-06-06 21:33 | 2.4M | |
![[ ]](/icons/layout.gif) | 2018-06-06_093633pm_List of Drug Registration 6-6-18_Revised_Finaly.pdf | 2018-06-06 21:36 | 2.4M | |
![[ ]](/icons/layout.gif) | 2018-06-07_031353pm_List of Drug Registration 6-6-18_Revised_Finaly.pdf | 2018-06-07 15:13 | 2.4M | |
![[ ]](/icons/layout.gif) | 2018-06-07_031456pm_List of Drug Registration 6-6-18_Revised_Finaly.pdf | 2018-06-07 15:14 | 2.4M | |
![[ ]](/icons/layout.gif) | 2018-06-08_011811pm_Regulation on Establishment on Export_Import Company.pdf | 2018-06-08 13:18 | 219K | |
![[ ]](/icons/layout.gif) | 2018-06-08_101534am_List of Drug Registration 06-06-2018.pdf | 2018-06-08 10:15 | 2.6M | |
![[ ]](/icons/layout.gif) | 2018-06-08_101644am_List of Drug Registration 06-06-2018.pdf | 2018-06-08 10:16 | 2.6M | |
![[ ]](/icons/layout.gif) | 2018-06-21_110524am_Codex General Principles of Food Hygiene.pdf | 2018-06-21 11:05 | 438K | |
![[ ]](/icons/layout.gif) | 2018-06-21_110823am_R1 RCP 1-1969 Rev 4-2003_Codex - translated by Vx.pdf | 2018-06-21 11:08 | 435K | |
![[ ]](/icons/layout.gif) | 2018-06-21_110903am_R1 RCP 1-1969 Rev 4-2003_Codex - translated by Vx.pdf | 2018-06-21 11:09 | 435K | |
![[ ]](/icons/layout.gif) | 2018-06-21_111404am_R1 RCP 1-1969 Rev 4-2003_Codex - translated by Vx.pdf | 2018-06-21 11:14 | 435K | |
![[ ]](/icons/layout.gif) | 2018-06-21_111613am_R1 RCP 1-1969 Rev 4-2003_Codex - translated by Vx.pdf | 2018-06-21 11:16 | 435K | |
![[ ]](/icons/layout.gif) | 2018-07-18_113129am_Regulation on Establishment on Export_Import Company.pdf | 2018-07-18 11:31 | 219K | |
![[ ]](/icons/layout.gif) | 2018-07-18_113410am_Regulation on Establishment on Export_Import Company.pdf | 2018-07-18 11:34 | 219K | |
![[ ]](/icons/layout.gif) | 2018-07-18_113527am_Regulation on Establishment on Export_Import Company.pdf | 2018-07-18 11:35 | 219K | |
![[ ]](/icons/layout.gif) | 2018-10-15_103826am_Unions Law .pdf | 2018-10-15 10:38 | 3.8M | |
![[ ]](/icons/layout.gif) | 2018-10-15_103934am_Unions Law .pdf | 2018-10-15 10:39 | 3.8M | |
![[TXT]](/icons/text.gif) | 2018-10-17_032744pm_Registration form of TM-HS-DS-FS-Local product (F1).dot | 2018-10-17 15:27 | 44K | |
![[TXT]](/icons/text.gif) | 2018-10-17_032934pm_Registration form of TM- HS-DS-FS-Local (F2).dot | 2018-10-17 15:29 | 91K | |
![[TXT]](/icons/text.gif) | 2018-10-17_033021pm_Registration form of TM-HS-DS-FS-Local product (F1).dot | 2018-10-17 15:30 | 44K | |
![[ ]](/icons/unknown.gif) | 2018-10-17_033144pm_Registration of TM,HS,DS and FS-local product (F3).doc | 2018-10-17 15:31 | 102K | |
![[ ]](/icons/unknown.gif) | 2018-10-17_033325pm_Registration form of TM-HS-FS-Imported Product (F1).doc | 2018-10-17 15:33 | 109K | |
![[ ]](/icons/unknown.gif) | 2018-10-17_033500pm_Registration form of TM,HS,FS-Imported product (F2).doc | 2018-10-17 15:35 | 143K | |
![[ ]](/icons/unknown.gif) | 2018-10-17_033812pm_Registration form of TM-HS-FS-Imported Product (F3).doc | 2018-10-17 15:38 | 206K | |
![[ ]](/icons/unknown.gif) | 2018-10-17_034131pm_Registration of TM,HS,DS and FS-local product (F3).doc | 2018-10-17 15:41 | 102K | |
![[TXT]](/icons/text.gif) | 2018-10-17_034241pm_Registration form of TM- HS-DS-FS-Local (F2).dot | 2018-10-17 15:42 | 91K | |
![[TXT]](/icons/text.gif) | 2018-10-17_034330pm_Registration form of TM-HS-DS-FS-Local product (F1).dot | 2018-10-17 15:43 | 44K | |
![[ ]](/icons/unknown.gif) | 2018-10-17_034451pm_Registration of TM,HS,DS and FS-local product (F3).doc | 2018-10-17 15:44 | 102K | |
![[ ]](/icons/unknown.gif) | 2018-10-17_034525pm_Registration form of TM,HS,FS-Imported product (F2).doc | 2018-10-17 15:45 | 143K | |
![[ ]](/icons/unknown.gif) | 2018-10-17_034555pm_Registration form of TM-HS-FS-Imported Product (F1).doc | 2018-10-17 15:45 | 109K | |
![[ ]](/icons/unknown.gif) | 2018-10-18_011140pm_Registration form of TM-HS-FS-Imported Product (F3).doc | 2018-10-18 13:11 | 206K | |
![[ ]](/icons/unknown.gif) | 2018-10-18_011249pm_Registration form of TM,HS,FS-Imported product (F2).doc | 2018-10-18 13:12 | 143K | |
![[ ]](/icons/unknown.gif) | 2018-10-18_011316pm_Registration form of TM-HS-FS-Imported Product (F1).doc | 2018-10-18 13:13 | 109K | |
![[ ]](/icons/unknown.gif) | 2018-10-18_011352pm_Registration form of TM-HS-FS-Imported Product (F3).doc | 2018-10-18 13:13 | 206K | |
![[ ]](/icons/unknown.gif) | 2018-10-18_011432pm_Registration form of TM,HS,FS-Imported product (F2).doc | 2018-10-18 13:14 | 143K | |
![[TXT]](/icons/text.gif) | 2018-10-18_011537pm_Registration form of TM-HS-FS Local product (F3).dot | 2018-10-18 13:15 | 91K | |
![[TXT]](/icons/text.gif) | 2018-10-18_011602pm_Registration form of TM- HS-DS-FS-Local (F2).dot | 2018-10-18 13:16 | 91K | |
![[TXT]](/icons/text.gif) | 2018-10-18_011626pm_Registration form of TM-HS-DS-FS-Local product (F1).dot | 2018-10-18 13:16 | 44K | |
![[ ]](/icons/unknown.gif) | 2018-11-01_121639pm_Registration form of TM-HS-DS-FS-Local (F3).doc | 2018-11-01 12:16 | 92K | |
![[ ]](/icons/unknown.gif) | 2018-11-01_121713pm_Registration form of TM-HS-DS-FS-Local (F2).doc | 2018-11-01 12:17 | 91K | |
![[ ]](/icons/unknown.gif) | 2018-11-01_121740pm_Registration form of TM-HS-DS-FS-Local (F1).doc | 2018-11-01 12:17 | 48K | |
![[ ]](/icons/unknown.gif) | 2019-03-15_100034am_2017-09-05_081050pm_request form for drinking water analysis (1).docx | 2019-03-15 10:00 | 56K | |
![[ ]](/icons/unknown.gif) | 2019-03-15_100202am_2017-09-05_080954pm_request form 1 for water soure analysis.docx | 2019-03-15 10:02 | 58K | |
![[ ]](/icons/unknown.gif) | 2019-03-15_100205am_2017-09-05_080954pm_request form 1 for water soure analysis.docx | 2019-03-15 10:02 | 58K | |
![[ ]](/icons/unknown.gif) | 2019-03-15_100242am_2017-09-05_081050pm_request form for drinking water analysis (1).docx | 2019-03-15 10:02 | 56K | |
![[ ]](/icons/layout.gif) | 2019-05-06_021738pm_Law on Medical Products (Eng).pdf | 2019-05-06 14:17 | 71K | |
![[ ]](/icons/layout.gif) | 2019-06-21_022648pm_02.2018[1].pdf | 2019-06-21 14:26 | 2.7M | |
![[ ]](/icons/unknown.gif) | 2019-07-02_095213am_Request_ for_ imported _medicine_ registration_ Form 1.doc | 2019-07-02 09:52 | 273K | |
![[ ]](/icons/unknown.gif) | 2019-07-03_101424am_Application Form No. 1 upated 2-7-2019.docx | 2019-07-03 10:14 | 186K | |
![[ ]](/icons/layout.gif) | 2019-07-05_100305am_Law on Medical Products (Eng).pdf | 2019-07-05 10:03 | 71K | |
![[ ]](/icons/layout.gif) | 2020-01-07_022704pm_Number Notification for December 2019 .pdf | 2020-01-07 14:27 | 1.8M | |
![[ ]](/icons/unknown.gif) | 2020-03-16_103517am_PICS GMP Lao version - Pre-final (1).docx | 2020-03-16 10:35 | 756K | |
![[ ]](/icons/layout.gif) | 2020-04-22_092741am_F3 Registration TM Form for imported product.pdf | 2020-04-22 09:27 | 33K | |
![[ ]](/icons/layout.gif) | 2020-04-22_092951am_F3 Registration TM Form for imported product.pdf | 2020-04-22 09:29 | 33K | |
![[ ]](/icons/layout.gif) | 2020-04-22_093400am_F3 Registration TM Form for imported product.pdf | 2020-04-22 09:34 | 33K | |
![[ ]](/icons/layout.gif) | 2020-04-22_093557am_F3 Registration HS Form form imported product.pdf | 2020-04-22 09:35 | 225K | |
![[ ]](/icons/layout.gif) | 2020-04-22_093714am_F2 Registration TM Form for imported product.pdf | 2020-04-22 09:37 | 99K | |
![[ ]](/icons/layout.gif) | 2020-04-22_093857am_F2 Registration HS Form for import product.pdf | 2020-04-22 09:38 | 303K | |
![[ ]](/icons/layout.gif) | 2020-04-22_094204am_F1 Registration of TM Form for import producted product.pdf | 2020-04-22 09:42 | 46K | |
![[ ]](/icons/layout.gif) | 2020-04-22_094442am_F1 Registration HS Form for Imported product.pdf | 2020-04-22 09:44 | 182K | |
![[ ]](/icons/layout.gif) | 2020-04-22_095923am_F 3 ຟອມຈົດທະບຽນຢາພື້ນເມືອງທີ່ຜະລິດພາຍໃນ-TL.pdf | 2020-04-22 09:59 | 77K | |
![[ ]](/icons/layout.gif) | 2020-04-22_100126am_F 3 ຟອມຈົດທະບຽນຢາພື້ນເມືອງທີ່ຜະລິດພາຍໃນ-TM-L.pdf | 2020-04-22 10:01 | 77K | |
![[ ]](/icons/layout.gif) | 2020-04-22_100336am_F 3 ຟອມຈົດທະບຽນຢາພື້ນເມືອງທີ່ຜະລິດພາຍໃນ-TM-L.pdf | 2020-04-22 10:03 | 77K | |
![[ ]](/icons/layout.gif) | 2020-04-22_100500am_F 3 ຟອມຈົດທະບຽນຢາພື້ນເມືອງທີ່ຜະລິດພາຍໃນ-TM-L.pdf | 2020-04-22 10:05 | 77K | |
![[ ]](/icons/layout.gif) | 2020-04-22_100640am_F 3 ຟອມຈົດທະບຽນຜະລິດຕະພັນເສີມສຸຂະພາບທີ່ຜະລິດພາຍໃນ-HS-L.pdf | 2020-04-22 10:06 | 78K | |
![[ ]](/icons/layout.gif) | 2020-04-22_100847am_F 2 ຟອມຈົດທະບຽນຜະລິດຕະພັນເສີມສຸຂະພາບທີ່ຜະລິດພາຍໃນ-HS-L.pdf | 2020-04-22 10:08 | 72K | |
![[ ]](/icons/layout.gif) | 2020-04-22_101129am_F 1 ຟອມຈົດທະບຽນຢາພື້ນເມືອງທີ່ຜະລິດພາຍໃນ-TM-L.pdf | 2020-04-22 10:11 | 76K | |
![[ ]](/icons/layout.gif) | 2020-04-22_101312am_F 1 ຟອມຈົດທະບຽນຜະລິດຕະພັນເສີມສຸຂະພາບທີ່ຜະລິດພາຍໃນ HS-L.pdf | 2020-04-22 10:13 | 60K | |
![[ ]](/icons/layout.gif) | 2020-04-22_102732am_ຟອມຄໍາຮ້ອງ-ສໍາລັບຜູ້ຊ່ວຍຮ້ານຂາຍຢາພື້ນເມືອງ.pdf | 2020-04-22 10:27 | 144K | |
![[ ]](/icons/layout.gif) | 2020-04-22_102846am_ຟອມຄໍາຮ້ອງ-ຂໍເປີດຮ້ານຂາຍຢາພືນເມືອງ.pdf | 2020-04-22 10:28 | 149K | |
![[ ]](/icons/layout.gif) | 2020-04-22_103037am_ຟອມຄໍາຮ້ອງ-ຂໍສ້າງຫ້ອງປຸງແຕ່ຢາພື້ນເມືອງແບບຫັດທະກໍາ.pdf | 2020-04-22 10:30 | 151K | |
![[ ]](/icons/layout.gif) | 2020-04-22_103218am_ຟອມຄໍາຮ້ອງ-ຂໍສ້າງຕັ້ງບໍລິສັດ-ໂຮງງານ-ສາຂາ.pdf | 2020-04-22 10:32 | 146K | |
![[ ]](/icons/layout.gif) | 2020-04-22_103422am_ຟອມຄໍາຮ້ອງ-ຂໍສ້າງຕັ້ງບໍລິສັດ-ໂຮງງານ-ສາຂາ.pdf | 2020-04-22 10:34 | 146K | |
![[ ]](/icons/layout.gif) | 2020-04-22_104051am_ຟອມຄໍາຮ້ອງຂໍແປ່ງແປງການຈົດທະບຽນ-Variation Form.pdf | 2020-04-22 10:40 | 65K | |
![[ ]](/icons/layout.gif) | 2020-04-22_104445am_ຟອມຄໍາຮ້ອງຂໍປ່ຽນແປງ (ພາສາລາວ).pdf | 2020-04-22 10:44 | 65K | |
![[ ]](/icons/layout.gif) | 2020-04-22_104740am_ຟອມຄໍາຮ້ອງຂໍປ່ຽນແປງ (ພາສາອັງກິດ).pdf | 2020-04-22 10:47 | 221K | |
![[ ]](/icons/unknown.gif) | 2020-05-14_013318pm_ໜັງສືສະເໜີຂໍແຜນນໍາເຂົ້າເຄມີທົ່ວໄປ.docx | 2020-05-14 13:33 | 54K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_071036am_ໜັງສືສະເໜີຂໍນໍາເຂົ້າເຄມີຕົ້ນ.docx | 2020-05-15 07:10 | 51K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_071353am_ໜັງສືສະເໜີຂໍນໍາເຂົ້າເຄມີທົ່ວໄປ.docx | 2020-05-15 07:13 | 42K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_071621am_ໜັງສືສະເໜີຂໍນໍາເຂົ້າເຄມີຕົ້ນ.docx | 2020-05-15 07:16 | 51K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_071943am_ໜັງສືສະເໜີຂໍນໍາເຂົ້າເຄມີຕົ້ນ.docx | 2020-05-15 07:19 | 51K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_072218am_ໜັງສືສະເໜີຂໍແຜນນໍາເຂົ້າເຄມີຕົ້ນ.docx | 2020-05-15 07:22 | 76K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_072604am_ໜັງສືສະເໜີຂໍແຜນນໍາເຂົ້າເຄມີທົ່ວໄປ.docx | 2020-05-15 07:26 | 54K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_074131am_ຂັ້ນຕອນການຂໍຂຶ້ນທະບຽນ-ຜະລິດຕະພັນເຄມີຄົວເຮືອນ.docx | 2020-05-15 07:41 | 47K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_074340am_ຂັ້ນຕອນການຂໍຂຶ້ນທະບຽນ-ຜະລິດຕະພັນເຄມີຄົວເຮືອນ.docx | 2020-05-15 07:43 | 47K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_074435am_ຂັ້ນຕອນການຂໍຂຶ້ນທະບຽນ-ຜະລິດຕະພັນເຄມີຄົວເຮືອນ.docx | 2020-05-15 07:44 | 47K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_074705am_ໜັງສືສະເໜີຂໍໃບອະນຸຍາດດ້ານວິຊາການ-ສໍາລັບຜະລິດຕະພັນເຄມີທີ່ໃຊ້ໃນຄົວເຮືອນ.docx | 2020-05-15 07:47 | 39K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_075120am_ໜັງສືສະເໜີຂໍອະນຸຍາດຂຶ້ນທະບຽນ-ຜະລິດຕະພັນເຄມີທີ່ໃຊ້ໃນຄົວເຮືອນ.docx | 2020-05-15 07:51 | 38K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_081204am_ຂັ້ນຕອນການຂໍຂຶ້ນທະບຽນ-ຜະລິດຕະພັນເຄມີຄົວເຮືອນ.docx | 2020-05-15 08:12 | 47K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_081421am_ໜັງສືສະເໜີຂໍໃບອະນຸຍາດດ້ານວິຊາການ-ສໍາລັບຜະລິດຕະພັນເຄມີທີ່ໃຊ້ໃນຄົວເຮືອນ.docx | 2020-05-15 08:14 | 39K | |
![[ ]](/icons/layout.gif) | 2020-05-15_091146am_ມາດຖານການຜະລິດທີ່ດີ PICS GMP Lao version - Final 15-5-2020.pdf | 2020-05-15 09:11 | 2.4M | |
![[ ]](/icons/unknown.gif) | 2020-05-15_104406am_ເຄມີຄວບຄຸມ - ໜັງສືສະເໜີຂໍນໍາເຂົ້າເຄມີຕົ້ນ.docx | 2020-05-15 10:44 | 51K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_104544am_ເຄມີຄວບຄຸມ - ໜັງສືສະເໜີຂໍນໍາເຂົ້າເຄມີທົ່ວໄປ.docx | 2020-05-15 10:45 | 42K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_105054am_ເຄມີຄວບຄຸມ - ໜັງສືສະເໜີຂໍນໍາເຂົ້າເຄມີທົ່ວໄປ.docx | 2020-05-15 10:50 | 42K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_105318am_ເຄມີ - ໜັງສືສະເໜີຂໍນໍາເຂົ້າເຄມີທົ່ວໄປ.docx | 2020-05-15 10:53 | 42K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_105526am_ເຄມີ - ໜັງສືສະເໜີຂໍນໍາເຂົ້າເຄມີຕົ້ນ.docx | 2020-05-15 10:55 | 51K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_110143am_ເຄມີ - ໜັງສືສະເໜີຂໍແຜນນໍາເຂົ້າເຄມີຕົ້ນ.docx | 2020-05-15 11:01 | 76K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_110722am_ເຄມີ - ໜັງສືສະເໜີຂໍແຜນນໍາເຂົ້າເຄມີທົ່ວໄປ.docx | 2020-05-15 11:07 | 54K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_111345am_ເຄມີ - ໜັງສືສະເໜີຂໍແຜນນໍາເຂົ້າເຄມີທົ່ວໄປ.docx | 2020-05-15 11:13 | 54K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_111633am_ເຄມີທີ່ໃຊ້ໃນຄົວເຮືອນ - ຂັ້ນຕອນການຂໍຂຶ້ນທະບຽນ.docx | 2020-05-15 11:16 | 47K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_111837am_ເຄມີທີ່ໃຊ້ໃນຄົວເຮືອນ - ໜັງສືສະເໜີຂໍໃບນຳສົ່ງວິໄຈ.docx | 2020-05-15 11:18 | 37K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_112033am_ເຄມີທີ່ໃຊ້ໃນຄົວເຮືອນ - ຮ່າງໜັງສືສະເໜີຂໍອະນຸຍາດ ຂຶ້ນທະບຽນ.docx | 2020-05-15 11:20 | 38K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_112235am_ເຄມີທີ່ໃຊໃນຄົວເຮືອນ - ຮ່າງໜັງສືສະເໜີ ຂໍອະນຸຍາດຜະລິດທົດລອງ.docx | 2020-05-15 11:22 | 45K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_113148am_ເຄື່ອງສໍາອາງ - ແບບຟອມຈົດແຈ້ງ (Cosmetic Notification from).doc | 2020-05-15 11:31 | 174K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_113337am_ເຄື່ອງສໍາອາງ- ຂໍ້ມູນ ແລະ ເອກະສານໃນການຂໍຜະລິດເຄື່ອງສໍາອາງ.docx | 2020-05-15 11:33 | 70K | |
![[ ]](/icons/unknown.gif) | 2020-05-15_113958am_ຢາເສບຕິດ, ວັດຖຸອອກລິດຕໍ່-ຈິດປະສາດ ແລະ ຢາຄວບຄຸມ - ຮ່າງໜັງສືສະເໜີຂໍນໍາເຂົ້າ.docx | 2020-05-15 11:39 | 71K | |
![[ ]](/icons/layout.gif) | 2020-05-25_111038am_ເອກະສານຊ້ອນທ້າຍ-VIII ຄູ່ມືກ່ຽວກັບການຜະລິດທີດີ final 25-5-20.pdf | 2020-05-25 11:10 | 767K | |
![[ ]](/icons/layout.gif) | 2020-05-25_111308am_ເອກະສານຊ້ອນທ້າຍ-VIII ຄູ່ມືກ່ຽວກັບການຜະລິດທີດີ final 25-5-20.pdf | 2020-05-25 11:13 | 767K | |
![[ ]](/icons/layout.gif) | 2020-05-25_112350am_ເອກະສານຊ້ອນທ້າຍ-VIII ຄູ່ມືກ່ຽວກັບການຜະລິດທີດີ final 25-5-20.pdf | 2020-05-25 11:23 | 766K | |
![[ ]](/icons/layout.gif) | 2020-05-25_112444am_ເອກະສານຊ້ອນທ້າຍ-VIII ຄູ່ມືກ່ຽວກັບການຜະລິດທີດີ final 25-5-20.pdf | 2020-05-25 11:24 | 766K | |
![[ ]](/icons/layout.gif) | 2020-05-27_111047am_ເອກະສານຊ້ອນທ້າຍ-VIII ຄູ່ມືກ່ຽວກັບການຜະລິດທີດີ final 25-5-20.pdf | 2020-05-27 11:10 | 766K | |
![[ ]](/icons/layout.gif) | 2020-05-29_105549am_ACD_Form.pdf | 2020-05-29 10:55 | 261K | |
![[TXT]](/icons/text.gif) | 2020-05-29_110027am_Ingredient.csv | 2020-05-29 11:00 | 92 | |
![[TXT]](/icons/text.gif) | 2020-05-29_110043am_Ingredient.csv | 2020-05-29 11:00 | 92 | |
![[ ]](/icons/layout.gif) | 2020-06-03_093341am_ເອກະສານຄັດຕິດທີ 2 ກ່ຽວກັບການກ່າວອ້າງ ແລະ ການພິສູດການກ່າວອ້າງສໍາາລັບ ພມ ສສພ.pdf | 2020-06-03 09:33 | 517K | |
![[ ]](/icons/layout.gif) | 2020-07-09_025351pm_Decree 155.ນຍ.pdf | 2020-07-09 14:53 | 318K | |
![[ ]](/icons/layout.gif) | 2020-07-20_010146pm_Annex III ASEAN Guidelines on Limits of Contaminations TM and HS V1.0(30.Oct14).pdf | 2020-07-20 13:01 | 222K | |
![[ ]](/icons/unknown.gif) | 2020-07-20_093428am_Annex II ASEAN GUIDING PRINCIPLES FOR THE USE OF ADDITIVES AND EXCIPIENTS IN TRADITIONAL MEDICINES AND HEALTH SUPPLEMENTS.doc | 2020-07-20 09:34 | 346K | |
![[ ]](/icons/layout.gif) | 2020-07-20_093648am_Annex II ASEAN GUIDING PRINCIPLES FOR THE USE OF ADDITIVES AND EXCIPIENTS IN TRADITIONAL MEDICINES AND HEALTH SUPPLEMENTS.pdf | 2020-07-20 09:36 | 507K | |
![[ ]](/icons/layout.gif) | 2020-07-20_104420am_Annex IX ASEAN Guidelines on labeling requirements for TM 27 May 2015.pdf | 2020-07-20 10:44 | 301K | |
![[ ]](/icons/layout.gif) | 2020-07-20_104707am_Annex IX ASEAN Guidelines on labeling requirements for TM 27 May 2015.pdf | 2020-07-20 10:47 | 301K | |
![[ ]](/icons/layout.gif) | 2020-07-20_123228pm_Annex IX ASEAN Guidelines on Labelling Req. for HS (2 Oct 2015).pdf | 2020-07-20 12:32 | 299K | |
![[ ]](/icons/layout.gif) | 2020-07-27_031555pm_ANNEX IX ASEAN GL on Labeling Requirements for TMHS.pdf | 2020-07-27 15:15 | 353K | |
![[ ]](/icons/layout.gif) | 2020-08-10_112447am_ເອກະສານຊ້ອນທ້າຍ-VIII ຄູ່ມືກ່ຽວກັບການຜະລິດທີດີ final 25-5-20 (2).pdf | 2020-08-10 11:24 | 768K | |
![[ ]](/icons/layout.gif) | 2020-09-16_015927pm_List of local Traditional Medicine product registed update to 30.4.20.pdf | 2020-09-16 13:59 | 346K | |
![[ ]](/icons/layout.gif) | 2020-09-16_020201pm_List of Imported Traditional Medicine registed - update to 30.4.20.pdf | 2020-09-16 14:02 | 389K | |
![[ ]](/icons/layout.gif) | 2020-09-16_020507pm_List of local Traditional Medicine product registed update to 30.4.20.pdf | 2020-09-16 14:05 | 346K | |
![[ ]](/icons/layout.gif) | 2020-09-16_020727pm_List of Imported Traditional Medicine registed - update to 30.4.20.pdf | 2020-09-16 14:07 | 389K | |
![[ ]](/icons/layout.gif) | 2020-09-16_021958pm_List of local Health Supplement product registerd update to 30.4.20.pdf | 2020-09-16 14:19 | 82K | |
![[ ]](/icons/layout.gif) | 2020-09-16_022307pm_List of imported Healt Supplement Product registed update to 30.4.20.pdf | 2020-09-16 14:23 | 601K | |
![[ ]](/icons/layout.gif) | 2020-09-16_110447am_50 Items of Medicinal Plant.pdf | 2020-09-16 11:04 | 7.5M | |
![[ ]](/icons/layout.gif) | 2020-09-16_111026am_50 Items of Medicinal Plant.pdf | 2020-09-16 11:10 | 7.5M | |
![[ ]](/icons/layout.gif) | 2020-09-16_111243am_50 Items of Medicinal Plant.pdf | 2020-09-16 11:12 | 7.5M | |
![[ ]](/icons/layout.gif) | 2020-09-21_034633pm_List of local Health Supplement product registerd update to 30.4.20.pdf | 2020-09-21 15:46 | 82K | |
![[ ]](/icons/layout.gif) | 2020-09-21_034853pm_List of local Health Supplement product registerd update to 30.4.20.pdf | 2020-09-21 15:48 | 82K | |
![[ ]](/icons/layout.gif) | 2020-09-21_041024pm_2020-07-20_104707am_Annex IV ASEAN Guidelines on labeling requirements for TM 27 May 2015.pdf | 2020-09-21 16:10 | 301K | |
![[ ]](/icons/layout.gif) | 2020-09-22_023305pm_2020-09-21_041024pm_2020-07-20_104707am_Annex IV ASEAN Guidelines on labeling requirements for TM 27 May 2015.pdf | 2020-09-22 14:33 | 301K | |
![[ ]](/icons/layout.gif) | 2020-09-22_024314pm_2020-09-21_041024pm_2020-07-20_104707am_Annex IV ASEAN Guidelines on labeling requirements for TM 27 May 2015.pdf | 2020-09-22 14:43 | 301K | |
![[ ]](/icons/layout.gif) | 2020-09-22_024823pm_2020-09-21_041024pm_2020-07-20_104707am_Annex IV ASEAN Guidelines on labeling requirements for TM 27 May 2015.pdf | 2020-09-22 14:48 | 301K | |
![[ ]](/icons/layout.gif) | 2020-09-22_025128pm_Annex IX ASEAN Guidelines on Labelling Req. for HS (2 Oct 2015).pdf | 2020-09-22 14:51 | 299K | |
![[IMG]](/icons/image2.gif) | 2020-10-15_105926am_cd6d4b49-3371-4880-9583-5c1f61908933.jpg | 2020-10-15 10:59 | 275K | |
![[ ]](/icons/layout.gif) | 2020-10-16_022950pm_Deegree number 155 PM on Medicinal Natural Resources.pdf | 2020-10-16 14:29 | 493K | |
![[ ]](/icons/layout.gif) | 2020-10-16_023611pm_Deegree number 155 PM on Medicinal Natural Resources.pdf | 2020-10-16 14:36 | 493K | |
![[ ]](/icons/layout.gif) | 2020-12-19_083052pm_Annex VIII Good Manufacturing Practice.pdf | 2020-12-19 20:30 | 484K | |
![[ ]](/icons/layout.gif) | 2020-12-21_042004pm_ASEAN GMP for Cosmetic.pdf | 2020-12-21 16:20 | 617K | |
![[ ]](/icons/layout.gif) | 2021-01-12_031938pm_Annex V ASEAN Stubility Study.pdf | 2021-01-12 15:19 | 669K | |
![[ ]](/icons/layout.gif) | 2021-01-12_032028pm_Annex V ASEAN Stubility Study.pdf | 2021-01-12 15:20 | 669K | |
![[ ]](/icons/layout.gif) | 2021-04-05_013854pm_ໂຄງຮ່າງແຜນແມ່ບົດສຳລັບໂຮງງານຜະລິດຢາ-Site Master File-SMF.pdf | 2021-04-05 13:38 | 184K | |
![[ ]](/icons/layout.gif) | 2021-04-05_014247pm_ໂຄງຮ່າງແຜນແມ່ບົດສຳລັບໂຮງງານຜະລິດຢາ-Site Master File-SMF.pdf | 2021-04-05 13:42 | 184K | |
![[ ]](/icons/layout.gif) | 2021-04-05_014552pm_Site Master File-SMF.pdf | 2021-04-05 13:45 | 184K | |
![[ ]](/icons/layout.gif) | 2021-04-05_014958pm_Site Master File-SMF.pdf | 2021-04-05 13:49 | 184K | |
![[ ]](/icons/layout.gif) | 2021-06-14_021144pm_ຂໍ້ຕົກລົງການນໍາໃຊ້ຢາວັກແຊງໃນພາວະສຸກເສີນ.pdf | 2021-06-14 14:11 | 729K | |
![[ ]](/icons/layout.gif) | 2021-06-14_021931pm_EUA Guideline(Eng)220221-1_8612 (1)-1_8972.pdf | 2021-06-14 14:19 | 437K | |
![[ ]](/icons/layout.gif) | 2021-06-14_022238pm_EUA Guideline(Eng)220221-1_8612 (1)-1_8972.pdf | 2021-06-14 14:22 | 437K | |
![[ ]](/icons/layout.gif) | 2021-06-14_022524pm_guideline for EUA 06042021-1_8976.pdf | 2021-06-14 14:25 | 381K | |
![[ ]](/icons/layout.gif) | 2021-06-14_022959pm_guideline for EUA 06042021-1_8976.pdf | 2021-06-14 14:29 | 381K | |
![[ ]](/icons/layout.gif) | 2021-07-26_085816am_ຈົດແຈ້ງເຄື່ອງສຳອາງສົ່ງຫົວໜ້າເບ 26-7-21.pdf | 2021-07-26 08:58 | 1.3M | |
![[ ]](/icons/layout.gif) | 2021-09-19_093348am_ຄູ່ມືຄຸ້ມຄອງຢາ ແລະ ອຸປະກອນ ຂັ້ນໂຮງໝໍນ້ອຍ.pdf | 2021-09-19 09:33 | 2.8M | |
![[ ]](/icons/unknown.gif) | 2021-09-19_095007am_PV Guideline.rar | 2021-09-19 09:50 | 1.5M | |
![[ ]](/icons/unknown.gif) | 2021-09-19_095446am_PV Guideline.rar | 2021-09-19 09:54 | 1.5M | |
![[ ]](/icons/layout.gif) | 2021-09-19_100118am_Final_of EML9th_Latest_Updated-01-August-2019.pdf | 2021-09-19 10:01 | 2.3M | |
![[ ]](/icons/layout.gif) | 2233 ຂໍ້ຕົກລົງວ່າດ້ວຍການຈັດຕັ້ງ ແລະ ການເຄື່ອນໄຫວຂອງ ສວປ.pdf | 2022-11-08 08:50 | 655K | |
![[ ]](/icons/layout.gif) | 1406188014PICS GMP Guideline for pharmaceutical factory.pdf | 2018-05-29 08:26 | 735K | |
![[ ]](/icons/unknown.gif) | 1410411385ຄໍາຮ້ອງຂໍຈົດທະບຽບຜະລິດຕະພັນອາຫານທີ່ນໍາເຂົ້າຈາກຕ່າງປະເທດ.doc | 2018-05-29 08:24 | 285K | |
![[ ]](/icons/unknown.gif) | 1410411649ຄໍາຮ້ອງຂໍຈົດທະບຽບຜະລິດຕະພກັນອາຫານທີ່ຜະລິດພາຍໃນປະເທດ.doc | 2018-05-29 08:24 | 285K | |
![[ ]](/icons/unknown.gif) | 1439910208Form No. 3.docx | 2018-05-29 08:23 | 191K | |
![[ ]](/icons/unknown.gif) | 1439910369Form No. 3.docx | 2018-05-29 08:22 | 191K | |
![[ ]](/icons/layout.gif) | 1441871940Controled list of medicines for specific use in hospital.pdf | 2018-05-29 08:22 | 3.0M | |
![[ ]](/icons/unknown.gif) | 1443683892Pharmacy form.doc | 2018-05-29 08:22 | 287K | |
![[ ]](/icons/unknown.gif) | 1443684487Pharmacy_assistance.doc | 2018-05-29 08:22 | 288K | |
![[ ]](/icons/layout.gif) | 1444228659ACD_Form.pdf | 2018-05-29 08:22 | 261K | |
![[TXT]](/icons/text.gif) | 1444228698Ingredient.csv | 2018-05-29 08:22 | 92 | |
![[ ]](/icons/layout.gif) | 1446254004Progress_report_on ASEAN_under_ACCSQ.pdf | 2018-05-29 08:21 | 394K | |
![[ ]](/icons/layout.gif) | 1447860463Process Validation-Laos.pdf | 2018-05-29 08:21 | 175K | |
![[ ]](/icons/layout.gif) | 1447860494Validation of Analytical- Laos.pdf | 2018-05-29 08:21 | 434K | |
![[ ]](/icons/layout.gif) | 1450408621Standard Law .pdf | 2018-05-29 08:22 | 5.5M | |
![[ ]](/icons/layout.gif) | 1450411276Tobacco Control Law .pdf | 2018-05-29 08:20 | 3.9M | |
![[ ]](/icons/layout.gif) | 1450411465Environmental Protection Law.pdf | 2018-05-29 08:20 | 6.5M | |
![[ ]](/icons/layout.gif) | 1450443855Curative Law .pdf | 2018-05-29 08:19 | 3.5M | |
![[ ]](/icons/layout.gif) | 1450444336Intellectual Property law .pdf | 2018-05-29 08:20 | 13M | |
![[ ]](/icons/layout.gif) | 1450445729Metrology Law (Amd 1) No. 36.NA-13 Dec 2013 Lao verson.pdf | 2018-05-29 08:19 | 268K | |
![[ ]](/icons/layout.gif) | 1450853415Alcohol control law.pdf | 2018-05-29 08:19 | 2.3M | |
![[ ]](/icons/layout.gif) | 1452399172Technical Documents (1).pdf | 2018-05-29 08:19 | 731K | |
![[ ]](/icons/layout.gif) | 1452399193Technical Documents (1).pdf | 2018-05-29 08:19 | 731K | |
![[ ]](/icons/layout.gif) | 1452522110Decree No.363.pdf | 2018-05-29 08:19 | 806K | |
![[ ]](/icons/layout.gif) | 1453611762PMU_REPORT.pdf | 2018-05-29 08:19 | 36K | |
![[ ]](/icons/layout.gif) | 1453703292HSIP-AF Audit report Y2014-2015.pdf | 2018-05-29 08:19 | 715K | |
![[ ]](/icons/layout.gif) | 1453710911Regulation on Phamacices.pdf | 2018-05-29 08:19 | 164K | |
![[ ]](/icons/layout.gif) | 1455504874Drug Registration.pdf | 2018-05-29 08:19 | 276K | |
![[ ]](/icons/layout.gif) | 1455505954Labell sticker for Food product.pdf | 2018-05-29 08:19 | 235K | |
![[ ]](/icons/layout.gif) | 1458183815ເຄຶ້àºàº‡àºªàº³àºàº²àº‡àº—ີ່ຈົດà»àºˆà»‰àº‡à»àº¥à»‰àº§.pdf | 2016-03-17 10:03 | 1.0M | |
![[ ]](/icons/layout.gif) | 1458183815ເຄຶ້ອງສຳອາງທີ່ຈົດແຈ້ງແລ້ວ.pdf | 2018-05-29 08:19 | 1.0M | |
![[ ]](/icons/layout.gif) | 1463498279List_of_registered_medicine_current_used_udate_June_2016.pdf | 2018-05-29 08:19 | 767K | |
![[ ]](/icons/layout.gif) | 1465086865ເອກະສານປະກອບຂຶ້ນທະບຽອາຫານເສີມ ນໍ້າເຂົ້າຈາກຕ່າງປະເທດ.pdf | 2018-05-29 08:19 | 102K | |
![[ ]](/icons/layout.gif) | 1465087914ເອກະສານປະກອບຂຶ້ນທະບຽອາຫານເສີມ ນໍ້າເຂົ້າຈາກຕ່າງປະເທດ.pdf | 2018-05-29 08:19 | 102K | |
![[ ]](/icons/layout.gif) | 1466739709Labelling for Food product.pdf | 2018-05-29 08:19 | 235K | |
![[ ]](/icons/layout.gif) | 1466741685Standard for I O DIN.pdf | 2018-05-29 08:18 | 178K | |
![[ ]](/icons/layout.gif) | 1466741994SPS for food sanitation.pdf | 2018-05-29 08:18 | 202K | |
![[ ]](/icons/layout.gif) | 1466742738Manufacturing and Import Export Food Safety.pdf | 2018-05-29 08:18 | 193K | |
![[ ]](/icons/layout.gif) | 1466743299Food registration.pdf | 2018-05-29 08:18 | 111K | |
![[ ]](/icons/layout.gif) | 1467796405Regulation on pharmaceutical and medical product establishment.pdf | 2018-05-29 08:18 | 215K | |
![[ ]](/icons/layout.gif) | 1467871828Regulation on Advetisement control revised 2016.pdf | 2018-05-29 08:18 | 243K | |
![[ ]](/icons/layout.gif) | 1467883727Current Regulation on Advertisement (2016).pdf | 2018-05-29 08:18 | 180K | |
![[ ]](/icons/unknown.gif) | 1468406872Priminister_Deegree_on_Medicinal_Plant.docx | 2018-05-29 08:18 | 171K | |
![[ ]](/icons/unknown.gif) | 1468832977Request_ for_ imported _medicine_ registration_ Form 1.doc | 2018-05-29 08:18 | 273K | |
![[ ]](/icons/unknown.gif) | 1468833113request_form_for_product_importation.docx | 2018-05-29 08:18 | 17K | |
![[ ]](/icons/unknown.gif) | 1468834273Request_form_for pharmacy_establishment.doc | 2018-05-29 08:18 | 288K | |
![[ ]](/icons/layout.gif) | 1469516444Good_Manufacturing_Practic_GMP.pdf | 2018-05-29 08:18 | 254K | |
![[ ]](/icons/layout.gif) | 1469516632Drug and Midical Manufacturer establishment.pdf | 2018-05-29 08:18 | 187K | |
![[ ]](/icons/layout.gif) | 1469516742Drug and Midical Manufacturer establishment.pdf | 2018-05-29 08:18 | 187K | |
![[ ]](/icons/layout.gif) | 1469680613Regulation on pharmaceutical and medical product establishment.pdf | 2018-05-29 08:18 | 215K | |
![[ ]](/icons/layout.gif) | 1469680667Regulation on Phamacices.pdf | 2018-05-29 08:18 | 164K | |
![[ ]](/icons/layout.gif) | 1470440859ຄໍາສັ່ງ 1146 ກຊສ ກຽ່ວກັບການຕິດຕາມກວດກາ ແລະ ວາງມາດຕະຖານຕໍ່ຢາບໍ່ຈົດທະບຽນ.pdf | 2018-05-29 08:18 | 351K | |
![[ ]](/icons/layout.gif) | 1470661606Destroy_Drug_and_medical_Product.pdf | 2018-05-29 08:18 | 296K | |
![[ ]](/icons/layout.gif) | 1471420624ກົດໝາຍວ່າດ້ວຍ ພະນັກງານ-ລັດຖະກອນ.pdf | 2018-05-29 08:18 | 1.7M | |
![[ ]](/icons/layout.gif) | 1471420747ກົດໝາຍວ່າດ້ວຍ ພະນັກງານ-ລັດຖະກອນ.pdf | 2018-05-29 08:17 | 1.7M | |
![[ ]](/icons/layout.gif) | 1471496896Copy of List of company update 18.8.16.pdf | 2018-05-29 08:17 | 211K | |
![[ ]](/icons/layout.gif) | 1474015868List_controled_medicines_prescribed_specific_use_in_hospital.pdf | 2018-05-29 08:17 | 3.0M | |
![[ ]](/icons/layout.gif) | 1474436263List of controled, precibed & OTC medicine.pdf | 2018-05-29 08:17 | 4.0M | |
![[ ]](/icons/unknown.gif) | 1474596000ຄໍາຮ້ອງຂໍອະນຸຍາດນໍາເຂົ້າຜະລິດຕະພັນອາຫານ.doc | 2018-05-29 08:16 | 283K | |
![[ ]](/icons/layout.gif) | 1474610204Phamacy Revised final 2017.pdf | 2018-05-29 08:16 | 342K | |
![[ ]](/icons/layout.gif) | 1399571875011 Database System for Retail & Wholesale Shop.pdf | 2018-05-29 08:28 | 4.4M | |
![[ ]](/icons/layout.gif) | 14574158871452399193Technical Documents (1).pdf | 2018-05-29 08:19 | 731K | |
![[ ]](/icons/layout.gif) | ASEAN JA Procedure for Pharmaceutical Products - Information for Applicants.pdf | 2023-03-16 08:01 | 326K | |
![[ ]](/icons/layout.gif) | ASEAN_Joint_Assessment_Process_for_Pharmaceutical_Products_Information_for_Applicants.pdf | 2020-12-23 08:46 | 708K | |
![[ ]](/icons/layout.gif) | ASEAN_Joint_Assessment_for_Pharmaceutical_Products_Public_Announcement.pdf | 2020-12-23 08:46 | 107K | |
![[ ]](/icons/layout.gif) | Agreement of POE FDD.pdf | 2023-04-10 12:07 | 349K | |
![[ ]](/icons/layout.gif) | COSMETIC-NOTIFICATION-MANUAL.pdf | 2021-11-02 15:08 | 1.2M | |
![[ ]](/icons/layout.gif) | COSMETIC NOTIFICATION MANUAL.pdf | 2022-06-30 14:22 | 1.2M | |
![[ ]](/icons/layout.gif) | Draft_Laos_COVID-19_Response_Project_P173817_ESCP_20200325_reviewed.pdf | 2020-03-26 20:59 | 304K | |
![[ ]](/icons/layout.gif) | Draft_Laos_COVID-19_Response_Project_P173817_SEP_20200325_reviewed.pdf | 2020-03-26 20:59 | 347K | |
![[ ]](/icons/layout.gif) | EMF_HANSA_Oct29_SLM.pdf | 2019-12-25 09:08 | 7.0M | |
![[ ]](/icons/layout.gif) | EUA-Guideline-for-Lao-06042021-1_8976.pdf | 2021-11-04 10:57 | 381K | |
![[ ]](/icons/layout.gif) | EUA-GuidelineEng220221-1_8612-1-1_8972.pdf | 2021-11-04 10:57 | 437K | |
![[ ]](/icons/layout.gif) | Enviromental_and_Social_Commitment Plan_(ESCP)-Eng_Clean.pdf | 2020-05-08 15:24 | 1.0M | |
![[ ]](/icons/layout.gif) | Environmental_and_Social_Commitment_Plan-(ESCP)-Eng_version_final.pdf | 2020-04-20 14:02 | 1.0M | |
![[ ]](/icons/layout.gif) | Environmental_and_Social_Commitment_Plan-(ESCP)-Lao_version_final.pdf | 2020-04-20 14:03 | 1.0M | |
![[ ]](/icons/layout.gif) | Ethical Book _Final for Printing.pdf | 2023-07-06 11:43 | 931K | |
![[ ]](/icons/layout.gif) | Executive_Summary_English_Version_final.pdf | 2020-05-08 15:24 | 574K | |
![[ ]](/icons/layout.gif) | Executive_Summary_Lao_Version-AK-27-April-2020-disclose.pdf | 2020-05-08 15:24 | 299K | |
![[ ]](/icons/layout.gif) | FDD_Donation_of_drug_and_medical_products_2003.pdf | 2023-02-02 14:12 | 165K | |
![[ ]](/icons/layout.gif) | FDD_Drug_Registration_2003.pdf | 2023-02-02 14:06 | 275K | |
![[ ]](/icons/layout.gif) | FDD_TOR_2021.pdf | 2023-07-13 07:42 | 4.9M | |
![[ ]](/icons/layout.gif) | Final_of EML9th_Latest_Updated-01-August-2019.pdf | 2019-10-16 16:34 | 2.3M | |
![[ ]](/icons/layout.gif) | Flow chart1.pdf | 2022-07-12 10:15 | 110K | |
![[ ]](/icons/layout.gif) | Food Law.pdf | 2022-04-28 07:24 | 2.6M | |
![[ ]](/icons/layout.gif) | Food Safety Policy (2009)_English.pdf | 2022-04-28 07:30 | 99K | |
![[ ]](/icons/layout.gif) | Food safety policy lao vers (1 PM).pdf | 2022-06-27 13:48 | 156K | |
![[ ]](/icons/layout.gif) | Frequently Asked Questions on the Joint Assessment Procedure.pdf | 2023-03-16 08:00 | 284K | |
![[ ]](/icons/compressed.gif) | Full_Reports_of_ESMF.zip | 2020-05-11 14:00 | 7.9M | |
![[ ]](/icons/layout.gif) | Guideline for cosmetic notification .eng.pdf | 2022-08-11 07:48 | 886K | |
![[ ]](/icons/layout.gif) | HANSA-EGDF_October_2019_Update_project_info_(ST).pdf | 2019-12-25 09:08 | 5.4M | |
![[ ]](/icons/layout.gif) | HANSA-Social_Assessment_Nov_2019_Fix_LFND_(AK).pdf | 2019-12-25 09:08 | 3.9M | |
![[ ]](/icons/layout.gif) | Hospital Strategy 23 Jun 2022_V08_2021-2030_SL.pdf | 2022-12-14 15:14 | 1.3M | |
![[ ]](/icons/layout.gif) | ISO13485 ພາສາລາວ final.pdf | 2022-04-27 09:24 | 257K | |
![[ ]](/icons/layout.gif) | LAO_PDR_COVID-19_ESMF_Final.pdf | 2020-05-22 08:38 | 3.8M | |
![[ ]](/icons/layout.gif) | LPH20190305.pdf | 2023-07-24 11:44 | 7.6M | |
![[ ]](/icons/layout.gif) | Lao_PDR_COVID-19_ESCP_Final.pdf | 2020-05-22 08:38 | 316K | |
![[ ]](/icons/layout.gif) | Lao_PDR_COVID-19_SEP_Final.pdf | 2020-05-22 08:38 | 410K | |
![[ ]](/icons/layout.gif) | Law on Medical Products (Eng).pdf | 2023-07-11 07:06 | 71K | |
![[ ]](/icons/layout.gif) | List_controled_medicines_prescribed_specific_use_in_hospital.pdf | 2023-01-26 13:46 | 3.0M | |
![[ ]](/icons/layout.gif) | List_of_priority_products_for_next_JA_activity.pdf | 2020-12-23 08:46 | 122K | |
![[ ]](/icons/layout.gif) | List of Priority Pharmaceutical Products for Joint Assessment Procedure (Nov 2022).pdf | 2023-03-16 08:03 | 129K | |
![[ ]](/icons/layout.gif) | Medicine and Medical Product Law.pdf | 2022-04-28 07:20 | 1.9M | |
![[ ]](/icons/layout.gif) | National Drug Policy (Lao version).pdf | 2022-06-27 13:42 | 1.0M | |
![[ ]](/icons/layout.gif) | National Medicine Formulary-FDD-Final.pdf | 2023-06-12 08:00 | 9.5M | |
![[ ]](/icons/layout.gif) | National Policy on the promotion of T&CM in Lao PDR.pdf | 2023-09-25 15:36 | 3.4M | |
![[ ]](/icons/layout.gif) | Operational of Good Warehouse Practice.pdf | 2021-12-22 15:36 | 4.6M | |
![[ ]](/icons/layout.gif) | Promotion_of_T&CM_in_Lao PDR.pdf | 2023-09-25 15:39 | 3.4M | |
![[ ]](/icons/layout.gif) | Promotion_of_T&CM_in_Lao_PDR.pdf | 2023-09-25 15:41 | 3.4M | |
![[ ]](/icons/layout.gif) | ROLE 770,ສທ6,4,22.pdf | 2022-07-04 13:45 | 8.4M | |
![[ ]](/icons/layout.gif) | Regulation-Reg.TM_No.169_25012022.pdf | 2023-01-27 15:25 | 5.1M | |
![[ ]](/icons/layout.gif) | Regulation HS reg.2626.MoH_21082023.pdf | 2023-08-23 07:04 | 5.6M | |
![[ ]](/icons/unknown.gif) | Regulation control hermp MOH 3789.PDF | 2023-01-24 08:04 | 7.2M | |
![[ ]](/icons/layout.gif) | Regulation on Drug Price Control.pdf | 2022-12-30 15:56 | 4.9M | |
![[ ]](/icons/layout.gif) | Regulation on TM_No.169_Eng.pdf | 2023-01-27 15:37 | 319K | |
![[ ]](/icons/layout.gif) | Regulation on Traditional Medicine Registration No 169_MoH 25 01 2022 in English version.pdf | 2022-03-30 08:00 | 317K | |
![[ ]](/icons/layout.gif) | Stakeholder_Engagement_Plan (SEP)-Eng_version_final.pdf | 2020-04-20 14:04 | 957K | |
![[ ]](/icons/layout.gif) | Stakeholder_Engagement_Plan_(SEP)-Eng_Clean.pdf | 2020-05-08 15:24 | 1.0M | |
![[ ]](/icons/layout.gif) | Stakeholder_Engagement_Plan_(SEP)-Lao_version_final.pdf | 2020-04-20 14:04 | 878K | |
![[ ]](/icons/layout.gif) | The_6_months_drug_safety_monitoning_report-27-08-23.pdf | 2023-09-25 10:21 | 257K | |
![[ ]](/icons/layout.gif) | damlat_570-pm_16-09-2021.pdf | 2021-10-12 23:53 | 2.4M | |
![[ ]](/icons/unknown.gif) | fm.php.pjpeg | 2023-09-29 01:14 | 77K | |
![[ ]](/icons/layout.gif) | guidelines for GRP final.pdf | 2023-05-04 15:45 | 665K | |
![[ ]](/icons/unknown.gif) | ramil.php.pjpeg | 2023-09-29 01:13 | 10K | |
|